C24H39NO6Si — CID 162417430
methyl (3R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[dimethyl(phenyl)silyl]pentanoate (PubChem CID 162417430) has the molecular formula C24H39NO6Si and a molecular weight of 465.66 g/mol. Its IUPAC name is methyl (3R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[dimethyl(phenyl)silyl]pentanoate.
| Compound Name | methyl (3R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[dimethyl(phenyl)silyl]pentanoate |
|---|---|
| PubChem CID | 162417430 |
| Molecular Formula | C24H39NO6Si |
| Molecular Weight | 465.66 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | methyl (3R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[dimethyl(phenyl)silyl]pentanoate |
| SMILES | CC[C@H](C(C(=O)OC)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C24H39NO6Si/c1-11-18(32(9,10)17-15-13-12-14-16-17)19(20(26)29-8)25(21(27)30-23(2,3)4)22(28)31-24(5,6)7/h12-16,18-19H,11H2,1-10H3/t18-,19?/m1/s1 |
| InChIKey | HMYKQLCSLRDJGV-MRTLOADZSA-N |
| XLogP | 5.10 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.66 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|