C22H35NO6Si — CID 162417417
methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[dimethyl(phenyl)silyl]propanoate (PubChem CID 162417417) has the molecular formula C22H35NO6Si and a molecular weight of 437.61 g/mol. Its IUPAC name is methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[dimethyl(phenyl)silyl]propanoate.
| Compound Name | methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[dimethyl(phenyl)silyl]propanoate |
|---|---|
| PubChem CID | 162417417 |
| Molecular Formula | C22H35NO6Si |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[dimethyl(phenyl)silyl]propanoate |
| SMILES | COC(=O)C(C[Si](C)(C)c1ccccc1)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H35NO6Si/c1-21(2,3)28-19(25)23(20(26)29-22(4,5)6)17(18(24)27-7)15-30(8,9)16-13-11-10-12-14-16/h10-14,17H,15H2,1-9H3 |
| InChIKey | NADASTYIOWNWFJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|