C25H25F8NO3S2 — CID 162418852
(3aR,9bR)-9b-(benzenesulfonyl)-3-[(R)-tert-butylsulfinyl]-8-fluoro-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole (PubChem CID 162418852) has the molecular formula C25H25F8NO3S2 and a molecular weight of 603.60 g/mol. Its IUPAC name is (3aR,9bR)-9b-(benzenesulfonyl)-3-[(R)-tert-butylsulfinyl]-8-fluoro-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole.
| Compound Name | (3aR,9bR)-9b-(benzenesulfonyl)-3-[(R)-tert-butylsulfinyl]-8-fluoro-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole |
|---|---|
| PubChem CID | 162418852 |
| Molecular Formula | C25H25F8NO3S2 |
| Molecular Weight | 603.60 g/mol |
| Exact Mass | 603.11 |
| IUPAC Name | (3aR,9bR)-9b-(benzenesulfonyl)-3-[(R)-tert-butylsulfinyl]-8-fluoro-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole |
| SMILES | CC(C)(C)[S@@](=O)N1CC[C@@]2(S(=O)(=O)c3ccccc3)c3cc(F)c(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C25H25F8NO3S2/c1-21(2,3)38(35)34-12-11-22(39(36,37)16-7-5-4-6-8-16)17-14-19(26)18(13-15(17)9-10-20(22)34)23(27,24(28,29)30)25(31,32)33/h4-8,13-14,20H,9-12H2,1-3H3/t20-,22-,38-/m1/s1 |
| InChIKey | CASGMLWOJSWADF-IXPUWVQRSA-N |
| XLogP | 6.27 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.60 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |