C13H18ClNO4S — CID 162426202
2-(4-chlorophenyl)-3-(2-methylpropanoylamino)propane-1-sulfonic acid (PubChem CID 162426202) has the molecular formula C13H18ClNO4S and a molecular weight of 319.81 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-(2-methylpropanoylamino)propane-1-sulfonic acid.
| Compound Name | 2-(4-chlorophenyl)-3-(2-methylpropanoylamino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 162426202 |
| Molecular Formula | C13H18ClNO4S |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 2-(4-chlorophenyl)-3-(2-methylpropanoylamino)propane-1-sulfonic acid |
| SMILES | CC(C)C(=O)NCC(CS(=O)(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H18ClNO4S/c1-9(2)13(16)15-7-11(8-20(17,18)19)10-3-5-12(14)6-4-10/h3-6,9,11H,7-8H2,1-2H3,(H,15,16)(H,17,18,19) |
| InChIKey | BAAIBQJDCVFIQX-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|