C22H23FN6 — CID 162431229
2-amino-4-fluoro-5-[(1R,2S,13R,14R,15S)-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraen-13-yl]benzenecarboximidamide (PubChem CID 162431229) has the molecular formula C22H23FN6 and a molecular weight of 390.47 g/mol. Its IUPAC name is 2-amino-4-fluoro-5-[(1R,2S,13R,14R,15S)-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraen-13-yl]benzenecarboximidamide.
| Compound Name | 2-amino-4-fluoro-5-[(1R,2S,13R,14R,15S)-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraen-13-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 162431229 |
| Molecular Formula | C22H23FN6 |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 2-amino-4-fluoro-5-[(1R,2S,13R,14R,15S)-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraen-13-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc([C@@H]2Nc3ccc4[nH]ncc4c3[C@H]3[C@@H]4CC[C@@H](C4)[C@H]32)c(F)cc1N |
| InChI | InChI=1S/C22H23FN6/c23-14-7-15(24)12(22(25)26)6-11(14)21-19-10-2-1-9(5-10)18(19)20-13-8-27-29-16(13)3-4-17(20)28-21/h3-4,6-10,18-19,21,28H,1-2,5,24H2,(H3,25,26)(H,27,29)/t9-,10+,18+,19-,21+/m1/s1 |
| InChIKey | RHEJJUGDWSOALZ-UUBOWHMOSA-N |
| XLogP | 3.86 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|