C22H33N3OS — CID 162435382
2-[4-(aminomethyl)piperidin-1-yl]ethanamine;4-[2-(methoxymethyl)phenyl]benzenethiol (PubChem CID 162435382) has the molecular formula C22H33N3OS and a molecular weight of 387.59 g/mol. Its IUPAC name is 2-[4-(aminomethyl)piperidin-1-yl]ethanamine;4-[2-(methoxymethyl)phenyl]benzenethiol.
| Compound Name | 2-[4-(aminomethyl)piperidin-1-yl]ethanamine;4-[2-(methoxymethyl)phenyl]benzenethiol |
|---|---|
| PubChem CID | 162435382 |
| Molecular Formula | C22H33N3OS |
| Molecular Weight | 387.59 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 2-[4-(aminomethyl)piperidin-1-yl]ethanamine;4-[2-(methoxymethyl)phenyl]benzenethiol |
| SMILES | COCc1ccccc1-c1ccc(S)cc1.NCCN1CCC(CN)CC1 |
| InChI | InChI=1S/C14H14OS.C8H19N3/c1-15-10-12-4-2-3-5-14(12)11-6-8-13(16)9-7-11;9-3-6-11-4-1-8(7-10)2-5-11/h2-9,16H,10H2,1H3;8H,1-7,9-10H2 |
| InChIKey | QJZXAWNDXXRLOO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.59 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|