C15H24F3N3OS — CID 162435343
2-[4-(aminomethyl)piperidin-1-yl]ethanamine;4-(trifluoromethoxy)benzenethiol (PubChem CID 162435343) has the molecular formula C15H24F3N3OS and a molecular weight of 351.44 g/mol. Its IUPAC name is 2-[4-(aminomethyl)piperidin-1-yl]ethanamine;4-(trifluoromethoxy)benzenethiol.
| Compound Name | 2-[4-(aminomethyl)piperidin-1-yl]ethanamine;4-(trifluoromethoxy)benzenethiol |
|---|---|
| PubChem CID | 162435343 |
| Molecular Formula | C15H24F3N3OS |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 2-[4-(aminomethyl)piperidin-1-yl]ethanamine;4-(trifluoromethoxy)benzenethiol |
| SMILES | FC(F)(F)Oc1ccc(S)cc1.NCCN1CCC(CN)CC1 |
| InChI | InChI=1S/C8H19N3.C7H5F3OS/c9-3-6-11-4-1-8(7-10)2-5-11;8-7(9,10)11-5-1-3-6(12)4-2-5/h8H,1-7,9-10H2;1-4,12H |
| InChIKey | QBTQFDSMPDMHDG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|