C13H18F3N3O3S — CID 18678680
2-[4-(aminomethyl)piperidin-1-yl]-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 18678680) has the molecular formula C13H18F3N3O3S and a molecular weight of 353.37 g/mol. Its IUPAC name is 2-[4-(aminomethyl)piperidin-1-yl]-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | 2-[4-(aminomethyl)piperidin-1-yl]-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 18678680 |
| Molecular Formula | C13H18F3N3O3S |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 2-[4-(aminomethyl)piperidin-1-yl]-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | NCC1CCN(c2cc(OC(F)(F)F)ccc2S(N)(=O)=O)CC1 |
| InChI | InChI=1S/C13H18F3N3O3S/c14-13(15,16)22-10-1-2-12(23(18,20)21)11(7-10)19-5-3-9(8-17)4-6-19/h1-2,7,9H,3-6,8,17H2,(H2,18,20,21) |
| InChIKey | VMOITQNQAGQZGG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |