C16H17Cl2NO4S — CID 162435606
3-chloro-N-(2-chloroethyl)-4-(2,6-dimethoxyphenyl)benzenesulfonamide (PubChem CID 162435606) has the molecular formula C16H17Cl2NO4S and a molecular weight of 390.29 g/mol. Its IUPAC name is 3-chloro-N-(2-chloroethyl)-4-(2,6-dimethoxyphenyl)benzenesulfonamide.
| Compound Name | 3-chloro-N-(2-chloroethyl)-4-(2,6-dimethoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 162435606 |
| Molecular Formula | C16H17Cl2NO4S |
| Molecular Weight | 390.29 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | 3-chloro-N-(2-chloroethyl)-4-(2,6-dimethoxyphenyl)benzenesulfonamide |
| SMILES | COc1cccc(OC)c1-c1ccc(S(=O)(=O)NCCCl)cc1Cl |
| InChI | InChI=1S/C16H17Cl2NO4S/c1-22-14-4-3-5-15(23-2)16(14)12-7-6-11(10-13(12)18)24(20,21)19-9-8-17/h3-7,10,19H,8-9H2,1-2H3 |
| InChIKey | WZAXHXLAKQTWFX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.29 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|