C19H21F3N2O3 — CID 162437392
(2E,4E)-2-[4-(2,6-difluoro-4-methoxyphenyl)-2-oxopyrrolidin-1-yl]-5-[ethyl(methyl)amino]-4-fluoropenta-2,4-dienal (PubChem CID 162437392) has the molecular formula C19H21F3N2O3 and a molecular weight of 382.38 g/mol. Its IUPAC name is (2E,4E)-2-[4-(2,6-difluoro-4-methoxyphenyl)-2-oxopyrrolidin-1-yl]-5-[ethyl(methyl)amino]-4-fluoropenta-2,4-dienal.
| Compound Name | (2E,4E)-2-[4-(2,6-difluoro-4-methoxyphenyl)-2-oxopyrrolidin-1-yl]-5-[ethyl(methyl)amino]-4-fluoropenta-2,4-dienal |
|---|---|
| PubChem CID | 162437392 |
| Molecular Formula | C19H21F3N2O3 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | (2E,4E)-2-[4-(2,6-difluoro-4-methoxyphenyl)-2-oxopyrrolidin-1-yl]-5-[ethyl(methyl)amino]-4-fluoropenta-2,4-dienal |
| SMILES | CCN(C)/C=C(F)\C=C(/C=O)N1CC(c2c(F)cc(OC)cc2F)CC1=O |
| InChI | InChI=1S/C19H21F3N2O3/c1-4-23(2)10-13(20)6-14(11-25)24-9-12(5-18(24)26)19-16(21)7-15(27-3)8-17(19)22/h6-8,10-12H,4-5,9H2,1-3H3/b13-10+,14-6+ |
| InChIKey | RVDKCVMAECHBST-KRDNBFTESA-N |
| XLogP | 3.13 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|