C22H27N5O3 — CID 162439055
2-(6-methylidene-2-oxopiperidin-3-yl)-5-[3-(4-methylpiperazin-1-yl)azetidin-1-yl]isoindole-1,3-dione (PubChem CID 162439055) has the molecular formula C22H27N5O3 and a molecular weight of 409.49 g/mol. Its IUPAC name is 2-(6-methylidene-2-oxopiperidin-3-yl)-5-[3-(4-methylpiperazin-1-yl)azetidin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-(6-methylidene-2-oxopiperidin-3-yl)-5-[3-(4-methylpiperazin-1-yl)azetidin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 162439055 |
| Molecular Formula | C22H27N5O3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 2-(6-methylidene-2-oxopiperidin-3-yl)-5-[3-(4-methylpiperazin-1-yl)azetidin-1-yl]isoindole-1,3-dione |
| SMILES | C=C1CCC(N2C(=O)c3ccc(N4CC(N5CCN(C)CC5)C4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C22H27N5O3/c1-14-3-6-19(20(28)23-14)27-21(29)17-5-4-15(11-18(17)22(27)30)26-12-16(13-26)25-9-7-24(2)8-10-25/h4-5,11,16,19H,1,3,6-10,12-13H2,2H3,(H,23,28) |
| InChIKey | ZGFOSEBORKDZPB-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|