C12H11N7OS — CID 162443651
6-[(5-thiophen-2-yltetrazol-2-yl)methyl]pyridine-3-carbohydrazide (PubChem CID 162443651) has the molecular formula C12H11N7OS and a molecular weight of 301.34 g/mol. Its IUPAC name is 6-[(5-thiophen-2-yltetrazol-2-yl)methyl]pyridine-3-carbohydrazide.
| Compound Name | 6-[(5-thiophen-2-yltetrazol-2-yl)methyl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 162443651 |
| Molecular Formula | C12H11N7OS |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 6-[(5-thiophen-2-yltetrazol-2-yl)methyl]pyridine-3-carbohydrazide |
| SMILES | NNC(=O)c1ccc(Cn2nnc(-c3cccs3)n2)nc1 |
| InChI | InChI=1S/C12H11N7OS/c13-15-12(20)8-3-4-9(14-6-8)7-19-17-11(16-18-19)10-2-1-5-21-10/h1-6H,7,13H2,(H,15,20) |
| InChIKey | AZXFXQPBVBMLPR-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|