C22H46O4Si2 — CID 162445776
(3S)-3-[tert-butyl(dimethyl)silyl]oxy-6-methyl-6-triethylsilyloxynon-8-enoic acid (PubChem CID 162445776) has the molecular formula C22H46O4Si2 and a molecular weight of 430.78 g/mol. Its IUPAC name is (3S)-3-[tert-butyl(dimethyl)silyl]oxy-6-methyl-6-triethylsilyloxynon-8-enoic acid.
| Compound Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-6-methyl-6-triethylsilyloxynon-8-enoic acid |
|---|---|
| PubChem CID | 162445776 |
| Molecular Formula | C22H46O4Si2 |
| Molecular Weight | 430.78 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-6-methyl-6-triethylsilyloxynon-8-enoic acid |
| SMILES | C=CCC(C)(CC[C@@H](CC(=O)O)O[Si](C)(C)C(C)(C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C22H46O4Si2/c1-11-16-22(8,26-28(12-2,13-3)14-4)17-15-19(18-20(23)24)25-27(9,10)21(5,6)7/h11,19H,1,12-18H2,2-10H3,(H,23,24)/t19-,22?/m0/s1 |
| InChIKey | IUNKSBHHHONQRT-YDNXMHBPSA-N |
| XLogP | 6.99 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.78 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|