C26H52O5Si2 — CID 11225810
(3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-5-oxodec-9-enoic acid (PubChem CID 11225810) has the molecular formula C26H52O5Si2 and a molecular weight of 500.87 g/mol. Its IUPAC name is (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-5-oxodec-9-enoic acid.
| Compound Name | (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-5-oxodec-9-enoic acid |
|---|---|
| PubChem CID | 11225810 |
| Molecular Formula | C26H52O5Si2 |
| Molecular Weight | 500.87 g/mol |
| Exact Mass | 500.34 |
| IUPAC Name | (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-5-oxodec-9-enoic acid |
| SMILES | C=C[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)C(C)(C)[C@H](CC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H52O5Si2/c1-16-18(2)22(31-33(14,15)25(7,8)9)19(3)23(29)26(10,11)20(17-21(27)28)30-32(12,13)24(4,5)6/h16,18-20,22H,1,17H2,2-15H3,(H,27,28)/t18-,19+,20-,22-/m0/s1 |
| InChIKey | RGACBPOYHRBHRW-IIZPIQPGSA-N |
| XLogP | 7.30 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.87 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|