C19H38O11 — CID 162454151
2-(2-hydroxyethoxymethoxymethoxymethoxymethoxymethoxymethoxymethoxy)butyl 2,2-dimethylbutanoate (PubChem CID 162454151) has the molecular formula C19H38O11 and a molecular weight of 442.50 g/mol. Its IUPAC name is 2-(2-hydroxyethoxymethoxymethoxymethoxymethoxymethoxymethoxymethoxy)butyl 2,2-dimethylbutanoate.
| Compound Name | 2-(2-hydroxyethoxymethoxymethoxymethoxymethoxymethoxymethoxymethoxy)butyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 162454151 |
| Molecular Formula | C19H38O11 |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 2-(2-hydroxyethoxymethoxymethoxymethoxymethoxymethoxymethoxymethoxy)butyl 2,2-dimethylbutanoate |
| SMILES | CCC(COC(=O)C(C)(C)CC)OCOCOCOCOCOCOCOCCO |
| InChI | InChI=1S/C19H38O11/c1-5-17(9-29-18(21)19(3,4)6-2)30-16-28-15-27-14-26-13-25-12-24-11-23-10-22-8-7-20/h17,20H,5-16H2,1-4H3 |
| InChIKey | ZWJLQTUMNPQAEI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 120.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|