C17H30O8 — CID 20793495
[3-(ethenoxymethoxy)-2-[(3-methoxy-3-oxopropoxy)methoxy]propyl] 2,2-dimethylbutanoate (PubChem CID 20793495) has the molecular formula C17H30O8 and a molecular weight of 362.42 g/mol. Its IUPAC name is [3-(ethenoxymethoxy)-2-[(3-methoxy-3-oxopropoxy)methoxy]propyl] 2,2-dimethylbutanoate.
| Compound Name | [3-(ethenoxymethoxy)-2-[(3-methoxy-3-oxopropoxy)methoxy]propyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 20793495 |
| Molecular Formula | C17H30O8 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | [3-(ethenoxymethoxy)-2-[(3-methoxy-3-oxopropoxy)methoxy]propyl] 2,2-dimethylbutanoate |
| SMILES | C=COCOCC(COC(=O)C(C)(C)CC)OCOCCC(=O)OC |
| InChI | InChI=1S/C17H30O8/c1-6-17(3,4)16(19)24-11-14(10-23-12-21-7-2)25-13-22-9-8-15(18)20-5/h7,14H,2,6,8-13H2,1,3-5H3 |
| InChIKey | GOVHIYWKXRGCSJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|