C12H9F3N5O2Y- — CID 162454165
N-(furan-2-ylmethyl)-8-(2,2,2-trifluoroethoxy)-2,7-dihydropurin-2-id-6-amine;yttrium (PubChem CID 162454165) has the molecular formula C12H9F3N5O2Y- and a molecular weight of 401.14 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-8-(2,2,2-trifluoroethoxy)-2,7-dihydropurin-2-id-6-amine;yttrium.
| Compound Name | N-(furan-2-ylmethyl)-8-(2,2,2-trifluoroethoxy)-2,7-dihydropurin-2-id-6-amine;yttrium |
|---|---|
| PubChem CID | 162454165 |
| Molecular Formula | C12H9F3N5O2Y- |
| Molecular Weight | 401.14 g/mol |
| Exact Mass | 400.98 |
| IUPAC Name | N-(furan-2-ylmethyl)-8-(2,2,2-trifluoroethoxy)-2,7-dihydropurin-2-id-6-amine;yttrium |
| SMILES | FC(F)(F)COc1nc2n[c-]nc(NCc3ccco3)c2[nH]1.[Y] |
| InChI | InChI=1S/C12H9F3N5O2.Y/c13-12(14,15)5-22-11-19-8-9(17-6-18-10(8)20-11)16-4-7-2-1-3-21-7;/h1-3H,4-5H2,(H2,16,17,18,19,20);/q-1; |
| InChIKey | FVTDZJSNPKFBRZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.14 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|