C7H13N3O4S — CID 162460104
1-(3-sulfamoylpropanoyl)azetidine-3-carboxamide (PubChem CID 162460104) has the molecular formula C7H13N3O4S and a molecular weight of 235.26 g/mol. Its IUPAC name is 1-(3-sulfamoylpropanoyl)azetidine-3-carboxamide.
| Compound Name | 1-(3-sulfamoylpropanoyl)azetidine-3-carboxamide |
|---|---|
| PubChem CID | 162460104 |
| Molecular Formula | C7H13N3O4S |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 1-(3-sulfamoylpropanoyl)azetidine-3-carboxamide |
| SMILES | NC(=O)C1CN(C(=O)CCS(N)(=O)=O)C1 |
| InChI | InChI=1S/C7H13N3O4S/c8-7(12)5-3-10(4-5)6(11)1-2-15(9,13)14/h5H,1-4H2,(H2,8,12)(H2,9,13,14) |
| InChIKey | MZCZSPJLONDAIN-UHFFFAOYSA-N |
| XLogP | -2.39 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |