C38H29F2IrN3-2 — CID 162460306
3,4-bis(2,6-dimethylphenyl)-2-phenyl-3H-pyrrole;2,6-difluoro-3-pyridin-2-ylbenzene-4-ide-1-carbonitrile;iridium (PubChem CID 162460306) has the molecular formula C38H29F2IrN3-2 and a molecular weight of 757.88 g/mol. Its IUPAC name is 3,4-bis(2,6-dimethylphenyl)-2-phenyl-3H-pyrrole;2,6-difluoro-3-pyridin-2-ylbenzene-4-ide-1-carbonitrile;iridium.
| Compound Name | 3,4-bis(2,6-dimethylphenyl)-2-phenyl-3H-pyrrole;2,6-difluoro-3-pyridin-2-ylbenzene-4-ide-1-carbonitrile;iridium |
|---|---|
| PubChem CID | 162460306 |
| Molecular Formula | C38H29F2IrN3-2 |
| Molecular Weight | 757.88 g/mol |
| Exact Mass | 758.20 |
| IUPAC Name | 3,4-bis(2,6-dimethylphenyl)-2-phenyl-3H-pyrrole;2,6-difluoro-3-pyridin-2-ylbenzene-4-ide-1-carbonitrile;iridium |
| SMILES | Cc1cccc(C)c1C1=CN=C(c2[c-]cccc2)C1c1c(C)cccc1C.N#Cc1c(F)c[c-]c(-c2ccccn2)c1F.[Ir] |
| InChI | InChI=1S/C26H24N.C12H5F2N2.Ir/c1-17-10-8-11-18(2)23(17)22-16-27-26(21-14-6-5-7-15-21)25(22)24-19(3)12-9-13-20(24)4;13-10-5-4-8(12(14)9(10)7-15)11-3-1-2-6-16-11;/h5-14,16,25H,1-4H3;1-3,5-6H;/q2*-1; |
| InChIKey | XNMMYGSBXVJNMR-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 49.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.88 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|