C14H32O7Si — CID 162461132
3-[2-[diethoxy(propan-2-yl)silyl]oxyethoxy]-2-(2-hydroxyethoxy)propan-1-ol (PubChem CID 162461132) has the molecular formula C14H32O7Si and a molecular weight of 340.49 g/mol. Its IUPAC name is 3-[2-[diethoxy(propan-2-yl)silyl]oxyethoxy]-2-(2-hydroxyethoxy)propan-1-ol.
| Compound Name | 3-[2-[diethoxy(propan-2-yl)silyl]oxyethoxy]-2-(2-hydroxyethoxy)propan-1-ol |
|---|---|
| PubChem CID | 162461132 |
| Molecular Formula | C14H32O7Si |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 3-[2-[diethoxy(propan-2-yl)silyl]oxyethoxy]-2-(2-hydroxyethoxy)propan-1-ol |
| SMILES | CCO[Si](OCC)(OCCOCC(CO)OCCO)C(C)C |
| InChI | InChI=1S/C14H32O7Si/c1-5-19-22(13(3)4,20-6-2)21-10-9-17-12-14(11-16)18-8-7-15/h13-16H,5-12H2,1-4H3 |
| InChIKey | IXWWHLQSKUBUHP-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|