C10H24O7Si — CID 162461189
2-[3-[dihydroxy(propan-2-yl)silyl]oxy-2-(2-hydroxyethoxy)propoxy]ethanol (PubChem CID 162461189) has the molecular formula C10H24O7Si and a molecular weight of 284.38 g/mol. Its IUPAC name is 2-[3-[dihydroxy(propan-2-yl)silyl]oxy-2-(2-hydroxyethoxy)propoxy]ethanol.
| Compound Name | 2-[3-[dihydroxy(propan-2-yl)silyl]oxy-2-(2-hydroxyethoxy)propoxy]ethanol |
|---|---|
| PubChem CID | 162461189 |
| Molecular Formula | C10H24O7Si |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-[3-[dihydroxy(propan-2-yl)silyl]oxy-2-(2-hydroxyethoxy)propoxy]ethanol |
| SMILES | CC(C)[Si](O)(O)OCC(COCCO)OCCO |
| InChI | InChI=1S/C10H24O7Si/c1-9(2)18(13,14)17-8-10(16-6-4-12)7-15-5-3-11/h9-14H,3-8H2,1-2H3 |
| InChIKey | PZWFIRKSXYXBQN-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|