C14H31NO8 — CID 138651323
2-[2-[2-[2,3-bis(2-hydroxyethoxy)propoxy]ethylperoxy]ethyl-methylamino]ethanol (PubChem CID 138651323) has the molecular formula C14H31NO8 and a molecular weight of 341.40 g/mol. Its IUPAC name is 2-[2-[2-[2,3-bis(2-hydroxyethoxy)propoxy]ethylperoxy]ethyl-methylamino]ethanol.
| Compound Name | 2-[2-[2-[2,3-bis(2-hydroxyethoxy)propoxy]ethylperoxy]ethyl-methylamino]ethanol |
|---|---|
| PubChem CID | 138651323 |
| Molecular Formula | C14H31NO8 |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 2-[2-[2-[2,3-bis(2-hydroxyethoxy)propoxy]ethylperoxy]ethyl-methylamino]ethanol |
| SMILES | CN(CCO)CCOOCCOCC(COCCO)OCCO |
| InChI | InChI=1S/C14H31NO8/c1-15(2-4-16)3-7-22-23-11-10-20-13-14(21-9-6-18)12-19-8-5-17/h14,16-18H,2-13H2,1H3 |
| InChIKey | LCUJZKJVJZJCKA-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|