C12H21NO4 — CID 162461405
2-(3,4,5,5-tetramethoxycyclohexa-1,3-dien-1-yl)ethanamine (PubChem CID 162461405) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is 2-(3,4,5,5-tetramethoxycyclohexa-1,3-dien-1-yl)ethanamine.
| Compound Name | 2-(3,4,5,5-tetramethoxycyclohexa-1,3-dien-1-yl)ethanamine |
|---|---|
| PubChem CID | 162461405 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 2-(3,4,5,5-tetramethoxycyclohexa-1,3-dien-1-yl)ethanamine |
| SMILES | COC1=C(OC)C(OC)(OC)CC(CCN)=C1 |
| InChI | InChI=1S/C12H21NO4/c1-14-10-7-9(5-6-13)8-12(16-3,17-4)11(10)15-2/h7H,5-6,8,13H2,1-4H3 |
| InChIKey | PUVIYBJIOUUBAO-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|