C16H20O4 — CID 151162901
3-methoxy-5-[2-(4-methoxyphenyl)ethyl]cyclohexa-2,4-diene-1,1-diol (PubChem CID 151162901) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is 3-methoxy-5-[2-(4-methoxyphenyl)ethyl]cyclohexa-2,4-diene-1,1-diol.
| Compound Name | 3-methoxy-5-[2-(4-methoxyphenyl)ethyl]cyclohexa-2,4-diene-1,1-diol |
|---|---|
| PubChem CID | 151162901 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 3-methoxy-5-[2-(4-methoxyphenyl)ethyl]cyclohexa-2,4-diene-1,1-diol |
| SMILES | COC1=CC(O)(O)CC(CCc2ccc(OC)cc2)=C1 |
| InChI | InChI=1S/C16H20O4/c1-19-14-7-5-12(6-8-14)3-4-13-9-15(20-2)11-16(17,18)10-13/h5-9,11,17-18H,3-4,10H2,1-2H3 |
| InChIKey | NAQIRJAQQQECJE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|