C8H14AuN5 — CID 162466110
CID 162466110 (PubChem CID 162466110) has the molecular formula C8H14AuN5 and a molecular weight of 377.20 g/mol.
| Compound Name | CID 162466110 |
|---|---|
| PubChem CID | 162466110 |
| Molecular Formula | C8H14AuN5 |
| Molecular Weight | 377.20 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | — |
| SMILES | CN1CCN(Cc2[c-]nn[nH]2)CC1.[Au+] |
| InChI | InChI=1S/C8H14N5.Au/c1-12-2-4-13(5-3-12)7-8-6-9-11-10-8;/h2-5,7H2,1H3,(H,9,10,11);/q-1;+1 |
| InChIKey | VHQOLVJRZXCGAH-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.20 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|