C17H15F3N4O3 — CID 162467044
(2,2,2-trifluoroacetyl) 1-[[6-(5-azaspiro[2.3]hexan-5-yl)-3-pyridinyl]methyl]pyrazole-4-carboxylate (PubChem CID 162467044) has the molecular formula C17H15F3N4O3 and a molecular weight of 380.33 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 1-[[6-(5-azaspiro[2.3]hexan-5-yl)-3-pyridinyl]methyl]pyrazole-4-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) 1-[[6-(5-azaspiro[2.3]hexan-5-yl)-3-pyridinyl]methyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 162467044 |
| Molecular Formula | C17H15F3N4O3 |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 1-[[6-(5-azaspiro[2.3]hexan-5-yl)-3-pyridinyl]methyl]pyrazole-4-carboxylate |
| SMILES | O=C(OC(=O)C(F)(F)F)c1cnn(Cc2ccc(N3CC4(CC4)C3)nc2)c1 |
| InChI | InChI=1S/C17H15F3N4O3/c18-17(19,20)15(26)27-14(25)12-6-22-24(8-12)7-11-1-2-13(21-5-11)23-9-16(10-23)3-4-16/h1-2,5-6,8H,3-4,7,9-10H2 |
| InChIKey | QYKYSPQPGHKNJQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|