C14H13N5O — CID 162467407
4,11-dimethyl-7-(5-methylfuran-2-yl)-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 162467407) has the molecular formula C14H13N5O and a molecular weight of 267.29 g/mol. Its IUPAC name is 4,11-dimethyl-7-(5-methylfuran-2-yl)-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4,11-dimethyl-7-(5-methylfuran-2-yl)-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 162467407 |
| Molecular Formula | C14H13N5O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 4,11-dimethyl-7-(5-methylfuran-2-yl)-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | Cc1nc2c3cc(C)[nH]c3nc(-c3ccc(C)o3)n2n1 |
| InChI | InChI=1S/C14H13N5O/c1-7-6-10-12(15-7)17-14(11-5-4-8(2)20-11)19-13(10)16-9(3)18-19/h4-6,15H,1-3H3 |
| InChIKey | WOTBSYSQVMOZOC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 72.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |