C12H19N5O9P2 — CID 162468654
[(3S,5R)-5-[2-methyl-4-(methylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate (PubChem CID 162468654) has the molecular formula C12H19N5O9P2 and a molecular weight of 439.26 g/mol. Its IUPAC name is [(3S,5R)-5-[2-methyl-4-(methylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(3S,5R)-5-[2-methyl-4-(methylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 162468654 |
| Molecular Formula | C12H19N5O9P2 |
| Molecular Weight | 439.26 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | [(3S,5R)-5-[2-methyl-4-(methylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate |
| SMILES | CNc1nc(C)nc2c([C@H]3C[C@H](OP(=O)(O)O)C(COP(=O)(O)O)O3)cnn12 |
| InChI | InChI=1S/C12H19N5O9P2/c1-6-15-11-7(4-14-17(11)12(13-2)16-6)8-3-9(26-28(21,22)23)10(25-8)5-24-27(18,19)20/h4,8-10H,3,5H2,1-2H3,(H,13,15,16)(H2,18,19,20)(H2,21,22,23)/t8-,9+,10?/m1/s1 |
| InChIKey | JLOTXCKNWMWMJR-ZDGBYWQASA-N |
| XLogP | -0.11 |
| TPSA | 197.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.26 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|