C20H27NO5 — CID 162470620
[(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-1-yl] (Z)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 162470620) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is [(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-1-yl] (Z)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | [(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-1-yl] (Z)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162470620 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | [(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-1-yl] (Z)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C\C(=O)O[C@]23CCC[C@H](CC2)N3C)cc(OC)c1OC |
| InChI | InChI=1S/C20H27NO5/c1-21-15-6-5-10-20(21,11-9-15)26-18(22)8-7-14-12-16(23-2)19(25-4)17(13-14)24-3/h7-8,12-13,15H,5-6,9-11H2,1-4H3/b8-7-/t15-,20-/m1/s1 |
| InChIKey | QZVKSDKOWPHMOS-HATLXYAMSA-N |
| XLogP | 3.24 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|