C45H29F3N2O3S2 — CID 162473617
[3,20-bis(N-phenylanilino)-12-thiapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2,4,6,8,10,14,16,18,20-decaen-10-yl] trifluoromethanesulfonate (PubChem CID 162473617) has the molecular formula C45H29F3N2O3S2 and a molecular weight of 766.87 g/mol. Its IUPAC name is [3,20-bis(N-phenylanilino)-12-thiapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2,4,6,8,10,14,16,18,20-decaen-10-yl] trifluoromethanesulfonate.
| Compound Name | [3,20-bis(N-phenylanilino)-12-thiapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2,4,6,8,10,14,16,18,20-decaen-10-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 162473617 |
| Molecular Formula | C45H29F3N2O3S2 |
| Molecular Weight | 766.87 g/mol |
| Exact Mass | 766.16 |
| IUPAC Name | [3,20-bis(N-phenylanilino)-12-thiapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2,4,6,8,10,14,16,18,20-decaen-10-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1c2ccccc2c(N(c2ccccc2)c2ccccc2)c2c1sc1c3ccccc3c(N(c3ccccc3)c3ccccc3)cc12)C(F)(F)F |
| InChI | InChI=1S/C45H29F3N2O3S2/c46-45(47,48)55(51,52)53-42-36-27-15-14-26-35(36)41(50(32-21-9-3-10-22-32)33-23-11-4-12-24-33)40-38-29-39(34-25-13-16-28-37(34)43(38)54-44(40)42)49(30-17-5-1-6-18-30)31-19-7-2-8-20-31/h1-29H |
| InChIKey | YIJAEFMZJCYBHJ-UHFFFAOYSA-N |
| XLogP | 13.53 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.87 |
| LogP ≤ 5 | 13.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|