C20H21FO5S — CID 162477283
cis-ethyl (1R,2S)-2-(3-fluorophenyl)-2-[(4-methylphenyl)sulfonyloxymethyl]cyclopropane-1-carboxylate (PubChem CID 162477283) has the molecular formula C20H21FO5S and a molecular weight of 392.45 g/mol. Its IUPAC name is cis-ethyl (1R,2S)-2-(3-fluorophenyl)-2-[(4-methylphenyl)sulfonyloxymethyl]cyclopropane-1-carboxylate.
| Compound Name | cis-ethyl (1R,2S)-2-(3-fluorophenyl)-2-[(4-methylphenyl)sulfonyloxymethyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 162477283 |
| Molecular Formula | C20H21FO5S |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | cis-ethyl (1R,2S)-2-(3-fluorophenyl)-2-[(4-methylphenyl)sulfonyloxymethyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@@]1(COS(=O)(=O)c1ccc(C)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C20H21FO5S/c1-3-25-19(22)18-12-20(18,15-5-4-6-16(21)11-15)13-26-27(23,24)17-9-7-14(2)8-10-17/h4-11,18H,3,12-13H2,1-2H3/t18-,20+/m0/s1 |
| InChIKey | LNZQGMGCHVCFEM-AZUAARDMSA-N |
| XLogP | 3.36 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|