C18H19FO4S — CID 167425239
[(1S,2R)-1-(3-fluorophenyl)-2-(hydroxymethyl)cyclopropyl]methyl 4-methylbenzenesulfonate (PubChem CID 167425239) has the molecular formula C18H19FO4S and a molecular weight of 350.41 g/mol. Its IUPAC name is [(1S,2R)-1-(3-fluorophenyl)-2-(hydroxymethyl)cyclopropyl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(1S,2R)-1-(3-fluorophenyl)-2-(hydroxymethyl)cyclopropyl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 167425239 |
| Molecular Formula | C18H19FO4S |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | [(1S,2R)-1-(3-fluorophenyl)-2-(hydroxymethyl)cyclopropyl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@]2(c3cccc(F)c3)C[C@H]2CO)cc1 |
| InChI | InChI=1S/C18H19FO4S/c1-13-5-7-17(8-6-13)24(21,22)23-12-18(10-15(18)11-20)14-3-2-4-16(19)9-14/h2-9,15,20H,10-12H2,1H3/t15-,18+/m0/s1 |
| InChIKey | FXZHBRDMWDGKHH-MAUKXSAKSA-N |
| XLogP | 2.79 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|