C13H32O6Si4 — CID 162481113
[[[[hydroxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]methyl 2-methylprop-2-enoate (PubChem CID 162481113) has the molecular formula C13H32O6Si4 and a molecular weight of 396.74 g/mol. Its IUPAC name is [[[[hydroxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]methyl 2-methylprop-2-enoate.
| Compound Name | [[[[hydroxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 162481113 |
| Molecular Formula | C13H32O6Si4 |
| Molecular Weight | 396.74 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | [[[[hydroxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O |
| InChI | InChI=1S/C13H32O6Si4/c1-12(2)13(14)16-11-20(3,4)17-22(7,8)19-23(9,10)18-21(5,6)15/h15H,1,11H2,2-10H3 |
| InChIKey | ZESVAQFHYMVYSG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.74 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|