C34H42O2SSn — CID 162486745
tributyl-[5-(2,6-diphenoxyphenyl)thiophen-2-yl]stannane (PubChem CID 162486745) has the molecular formula C34H42O2SSn and a molecular weight of 633.49 g/mol. Its IUPAC name is tributyl-[5-(2,6-diphenoxyphenyl)thiophen-2-yl]stannane.
| Compound Name | tributyl-[5-(2,6-diphenoxyphenyl)thiophen-2-yl]stannane |
|---|---|
| PubChem CID | 162486745 |
| Molecular Formula | C34H42O2SSn |
| Molecular Weight | 633.49 g/mol |
| Exact Mass | 634.19 |
| IUPAC Name | tributyl-[5-(2,6-diphenoxyphenyl)thiophen-2-yl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc(-c2c(Oc3ccccc3)cccc2Oc2ccccc2)s1 |
| InChI | InChI=1S/C22H15O2S.3C4H9.Sn/c1-3-9-17(10-4-1)23-19-13-7-14-20(22(19)21-15-8-16-25-21)24-18-11-5-2-6-12-18;3*1-3-4-2;/h1-15H;3*1,3-4H2,2H3; |
| InChIKey | XHDCMBLZGYFESI-UHFFFAOYSA-N |
| XLogP | 11.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.49 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |