C20H19BFNO2 — CID 162488222
1-(8-fluoro-9-oxa-7-azonia-8-boranuidatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),2,4,6,11,13,15,17-octaen-8-yl)-2,2-dimethylpropan-1-one (PubChem CID 162488222) has the molecular formula C20H19BFNO2 and a molecular weight of 335.19 g/mol. Its IUPAC name is 1-(8-fluoro-9-oxa-7-azonia-8-boranuidatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),2,4,6,11,13,15,17-octaen-8-yl)-2,2-dimethylpropan-1-one.
| Compound Name | 1-(8-fluoro-9-oxa-7-azonia-8-boranuidatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),2,4,6,11,13,15,17-octaen-8-yl)-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 162488222 |
| Molecular Formula | C20H19BFNO2 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 1-(8-fluoro-9-oxa-7-azonia-8-boranuidatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),2,4,6,11,13,15,17-octaen-8-yl)-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)[B-]1(F)Oc2ccc3ccccc3c2-c2cccc[n+]21 |
| InChI | InChI=1S/C20H19BFNO2/c1-20(2,3)19(24)21(22)23-13-7-6-10-16(23)18-15-9-5-4-8-14(15)11-12-17(18)25-21/h4-13H,1-3H3 |
| InChIKey | SVXCSRDAMWXCET-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|