C42H46N5OPt- — CID 162491759
2-[1-[2,6-di(propan-2-yl)cyclohepta-1,3,5-trien-1-yl]-4-[3-[4-[2,6-di(propan-2-yl)phenyl]-1,2,4-triazol-3-yl]benzene-2-id-1-yl]imidazol-2-yl]phenol;platinum (PubChem CID 162491759) has the molecular formula C42H46N5OPt- and a molecular weight of 831.94 g/mol. Its IUPAC name is 2-[1-[2,6-di(propan-2-yl)cyclohepta-1,3,5-trien-1-yl]-4-[3-[4-[2,6-di(propan-2-yl)phenyl]-1,2,4-triazol-3-yl]benzene-2-id-1-yl]imidazol-2-yl]phenol;platinum.
| Compound Name | 2-[1-[2,6-di(propan-2-yl)cyclohepta-1,3,5-trien-1-yl]-4-[3-[4-[2,6-di(propan-2-yl)phenyl]-1,2,4-triazol-3-yl]benzene-2-id-1-yl]imidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 162491759 |
| Molecular Formula | C42H46N5OPt- |
| Molecular Weight | 831.94 g/mol |
| Exact Mass | 831.34 |
| IUPAC Name | 2-[1-[2,6-di(propan-2-yl)cyclohepta-1,3,5-trien-1-yl]-4-[3-[4-[2,6-di(propan-2-yl)phenyl]-1,2,4-triazol-3-yl]benzene-2-id-1-yl]imidazol-2-yl]phenol;platinum |
| SMILES | CC(C)C1=CC=CC(C(C)C)=C(n2cc(-c3[c-]c(-c4nncn4-c4c(C(C)C)cccc4C(C)C)ccc3)nc2-c2ccccc2O)C1.[Pt] |
| InChI | InChI=1S/C42H46N5O.Pt/c1-26(2)30-14-12-18-33(27(3)4)38(23-30)46-24-37(44-42(46)36-17-9-10-21-39(36)48)31-15-11-16-32(22-31)41-45-43-25-47(41)40-34(28(5)6)19-13-20-35(40)29(7)8;/h9-21,24-29,48H,23H2,1-8H3;/q-1; |
| InChIKey | IZTBWTCLNJOATD-UHFFFAOYSA-N |
| XLogP | 10.62 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.94 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|