C20H26N2O — CID 162491948
N'-[2,6-di(propan-2-yl)phenyl]-2-methoxybenzenecarboximidamide (PubChem CID 162491948) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is N'-[2,6-di(propan-2-yl)phenyl]-2-methoxybenzenecarboximidamide.
| Compound Name | N'-[2,6-di(propan-2-yl)phenyl]-2-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 162491948 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | N'-[2,6-di(propan-2-yl)phenyl]-2-methoxybenzenecarboximidamide |
| SMILES | COc1ccccc1/C(N)=N/c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C20H26N2O/c1-13(2)15-10-8-11-16(14(3)4)19(15)22-20(21)17-9-6-7-12-18(17)23-5/h6-14H,1-5H3,(H2,21,22) |
| InChIKey | VXRQMPBEVXYLKR-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|