C27H36BN3O5 — CID 162492712
tert-butyl 4-[1-(oxan-2-yl)pyrazol-4-yl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate (PubChem CID 162492712) has the molecular formula C27H36BN3O5 and a molecular weight of 493.41 g/mol. Its IUPAC name is tert-butyl 4-[1-(oxan-2-yl)pyrazol-4-yl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(oxan-2-yl)pyrazol-4-yl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate |
|---|---|
| PubChem CID | 162492712 |
| Molecular Formula | C27H36BN3O5 |
| Molecular Weight | 493.41 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | tert-butyl 4-[1-(oxan-2-yl)pyrazol-4-yl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ccc2c(-c3cnn(C4CCCCO4)c3)ccc(B3OC(C)(C)C(C)(C)O3)c21 |
| InChI | InChI=1S/C27H36BN3O5/c1-25(2,3)34-24(32)30-14-13-20-19(18-16-29-31(17-18)22-10-8-9-15-33-22)11-12-21(23(20)30)28-35-26(4,5)27(6,7)36-28/h11-14,16-17,22H,8-10,15H2,1-7H3 |
| InChIKey | MGSHJKIUIZHGET-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 76.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.41 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|