C22H36BN3O5 — CID 170810232
tert-butyl N-[3-[1-[(2S)-oxan-2-yl]pyrazol-4-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170810232) has the molecular formula C22H36BN3O5 and a molecular weight of 433.36 g/mol. Its IUPAC name is tert-butyl N-[3-[1-[(2S)-oxan-2-yl]pyrazol-4-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-[1-[(2S)-oxan-2-yl]pyrazol-4-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170810232 |
| Molecular Formula | C22H36BN3O5 |
| Molecular Weight | 433.36 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | tert-butyl N-[3-[1-[(2S)-oxan-2-yl]pyrazol-4-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=Cc1cnn([C@@H]2CCCCO2)c1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H36BN3O5/c1-20(2,3)29-19(27)24-14-17(23-30-21(4,5)22(6,7)31-23)12-16-13-25-26(15-16)18-10-8-9-11-28-18/h12-13,15,18H,8-11,14H2,1-7H3,(H,24,27)/t18-/m0/s1 |
| InChIKey | RFEKCSLPFTYIMT-SFHVURJKSA-N |
| XLogP | 4.12 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|