C16H16ClIrN2O3 — CID 162497299
carbanide;chloroiridium(2+);N-(4-methoxyphenyl)-1-(4-nitrobenzene-6-id-1-yl)ethanimine (PubChem CID 162497299) has the molecular formula C16H16ClIrN2O3 and a molecular weight of 511.99 g/mol. Its IUPAC name is carbanide;chloroiridium(2+);N-(4-methoxyphenyl)-1-(4-nitrobenzene-6-id-1-yl)ethanimine.
| Compound Name | carbanide;chloroiridium(2+);N-(4-methoxyphenyl)-1-(4-nitrobenzene-6-id-1-yl)ethanimine |
|---|---|
| PubChem CID | 162497299 |
| Molecular Formula | C16H16ClIrN2O3 |
| Molecular Weight | 511.99 g/mol |
| Exact Mass | 512.05 |
| IUPAC Name | carbanide;chloroiridium(2+);N-(4-methoxyphenyl)-1-(4-nitrobenzene-6-id-1-yl)ethanimine |
| SMILES | COc1ccc(/N=C(\C)c2[c-]cc([N+](=O)[O-])cc2)cc1.Cl[Ir+2].[CH3-] |
| InChI | InChI=1S/C15H13N2O3.CH3.ClH.Ir/c1-11(12-3-7-14(8-4-12)17(18)19)16-13-5-9-15(20-2)10-6-13;;;/h3,5-10H,1-2H3;1H3;1H;/q2*-1;;+3/p-1/b16-11+;;; |
| InChIKey | ALDHPLZUGDSRPE-KOWHYRDCSA-M |
| XLogP | 4.68 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.99 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|