C31H30NOS+ — CID 162500400
2-methyl-8-(2-methylpropyl)-1-(3,7,9-trimethyldibenzofuran-4-yl)-[1]benzothiolo[2,3-c]pyridin-2-ium (PubChem CID 162500400) has the molecular formula C31H30NOS+ and a molecular weight of 464.65 g/mol. Its IUPAC name is 2-methyl-8-(2-methylpropyl)-1-(3,7,9-trimethyldibenzofuran-4-yl)-[1]benzothiolo[2,3-c]pyridin-2-ium.
| Compound Name | 2-methyl-8-(2-methylpropyl)-1-(3,7,9-trimethyldibenzofuran-4-yl)-[1]benzothiolo[2,3-c]pyridin-2-ium |
|---|---|
| PubChem CID | 162500400 |
| Molecular Formula | C31H30NOS+ |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 2-methyl-8-(2-methylpropyl)-1-(3,7,9-trimethyldibenzofuran-4-yl)-[1]benzothiolo[2,3-c]pyridin-2-ium |
| SMILES | Cc1cc(C)c2c(c1)oc1c(-c3c4sc5c(CC(C)C)cccc5c4cc[n+]3C)c(C)ccc12 |
| InChI | InChI=1S/C31H30NOS/c1-17(2)14-21-8-7-9-22-23-12-13-32(6)28(31(23)34-30(21)22)27-19(4)10-11-24-26-20(5)15-18(3)16-25(26)33-29(24)27/h7-13,15-17H,14H2,1-6H3/q+1 |
| InChIKey | YCIRUEOMHRXFIA-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|