C32H32NOS+ — CID 162500392
2-methyl-7-(2-methylpropyl)-1-(2,3,7,9-tetramethyldibenzofuran-4-yl)-[1]benzothiolo[2,3-c]pyridin-2-ium (PubChem CID 162500392) has the molecular formula C32H32NOS+ and a molecular weight of 478.68 g/mol. Its IUPAC name is 2-methyl-7-(2-methylpropyl)-1-(2,3,7,9-tetramethyldibenzofuran-4-yl)-[1]benzothiolo[2,3-c]pyridin-2-ium.
| Compound Name | 2-methyl-7-(2-methylpropyl)-1-(2,3,7,9-tetramethyldibenzofuran-4-yl)-[1]benzothiolo[2,3-c]pyridin-2-ium |
|---|---|
| PubChem CID | 162500392 |
| Molecular Formula | C32H32NOS+ |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | 2-methyl-7-(2-methylpropyl)-1-(2,3,7,9-tetramethyldibenzofuran-4-yl)-[1]benzothiolo[2,3-c]pyridin-2-ium |
| SMILES | Cc1cc(C)c2c(c1)oc1c(-c3c4sc5cc(CC(C)C)ccc5c4cc[n+]3C)c(C)c(C)cc12 |
| InChI | InChI=1S/C32H32NOS/c1-17(2)12-22-8-9-23-24-10-11-33(7)30(32(24)35-27(23)16-22)29-21(6)19(4)15-25-28-20(5)13-18(3)14-26(28)34-31(25)29/h8-11,13-17H,12H2,1-7H3/q+1 |
| InChIKey | XBYQHEHKTJBQSQ-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|