C31H26F3NOS — CID 162500342
7-(3,3,3-trifluoro-2,2-dimethylpropyl)-1-(2,7,9-trimethyldibenzofuran-4-yl)-[1]benzothiolo[2,3-c]pyridine (PubChem CID 162500342) has the molecular formula C31H26F3NOS and a molecular weight of 517.62 g/mol. Its IUPAC name is 7-(3,3,3-trifluoro-2,2-dimethylpropyl)-1-(2,7,9-trimethyldibenzofuran-4-yl)-[1]benzothiolo[2,3-c]pyridine.
| Compound Name | 7-(3,3,3-trifluoro-2,2-dimethylpropyl)-1-(2,7,9-trimethyldibenzofuran-4-yl)-[1]benzothiolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 162500342 |
| Molecular Formula | C31H26F3NOS |
| Molecular Weight | 517.62 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | 7-(3,3,3-trifluoro-2,2-dimethylpropyl)-1-(2,7,9-trimethyldibenzofuran-4-yl)-[1]benzothiolo[2,3-c]pyridine |
| SMILES | Cc1cc(C)c2c(c1)oc1c(-c3nccc4c3sc3cc(CC(C)(C)C(F)(F)F)ccc34)cc(C)cc12 |
| InChI | InChI=1S/C31H26F3NOS/c1-16-10-18(3)26-22-11-17(2)12-23(28(22)36-24(26)13-16)27-29-21(8-9-35-27)20-7-6-19(14-25(20)37-29)15-30(4,5)31(32,33)34/h6-14H,15H2,1-5H3 |
| InChIKey | LESNBKWAWPJKFN-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.62 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |