C23H26FN3O — CID 162501547
(E)-N-[2-[(1R,5S)-3-[2-(4-fluorophenyl)ethyl]-3-azabicyclo[3.1.0]hexan-6-yl]ethyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 162501547) has the molecular formula C23H26FN3O and a molecular weight of 379.48 g/mol. Its IUPAC name is (E)-N-[2-[(1R,5S)-3-[2-(4-fluorophenyl)ethyl]-3-azabicyclo[3.1.0]hexan-6-yl]ethyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[2-[(1R,5S)-3-[2-(4-fluorophenyl)ethyl]-3-azabicyclo[3.1.0]hexan-6-yl]ethyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 162501547 |
| Molecular Formula | C23H26FN3O |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | (E)-N-[2-[(1R,5S)-3-[2-(4-fluorophenyl)ethyl]-3-azabicyclo[3.1.0]hexan-6-yl]ethyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccnc1)NCCC1[C@H]2CN(CCc3ccc(F)cc3)C[C@@H]12 |
| InChI | InChI=1S/C23H26FN3O/c24-19-6-3-17(4-7-19)10-13-27-15-21-20(22(21)16-27)9-12-26-23(28)8-5-18-2-1-11-25-14-18/h1-8,11,14,20-22H,9-10,12-13,15-16H2,(H,26,28)/b8-5+/t20?,21-,22+ |
| InChIKey | SHTJKPMJJKATIY-ZGKNAGQNSA-N |
| XLogP | 3.16 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|