C23H28N3O2P — CID 162501654
(E)-N-[2-[3-(3-dimethylphosphorylphenyl)-3-azabicyclo[3.1.0]hexan-6-yl]ethyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 162501654) has the molecular formula C23H28N3O2P and a molecular weight of 409.47 g/mol. Its IUPAC name is (E)-N-[2-[3-(3-dimethylphosphorylphenyl)-3-azabicyclo[3.1.0]hexan-6-yl]ethyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[2-[3-(3-dimethylphosphorylphenyl)-3-azabicyclo[3.1.0]hexan-6-yl]ethyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 162501654 |
| Molecular Formula | C23H28N3O2P |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | (E)-N-[2-[3-(3-dimethylphosphorylphenyl)-3-azabicyclo[3.1.0]hexan-6-yl]ethyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | CP(C)(=O)c1cccc(N2CC3C(CCNC(=O)/C=C/c4cccnc4)C3C2)c1 |
| InChI | InChI=1S/C23H28N3O2P/c1-29(2,28)19-7-3-6-18(13-19)26-15-21-20(22(21)16-26)10-12-25-23(27)9-8-17-5-4-11-24-14-17/h3-9,11,13-14,20-22H,10,12,15-16H2,1-2H3,(H,25,27)/b9-8+ |
| InChIKey | STJFFPXZHNIWAL-CMDGGOBGSA-N |
| XLogP | 3.23 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|