C21H22FN3O — CID 162502119
(E)-N-[2-[3-(3-fluorophenyl)-3-azabicyclo[3.1.0]hexan-6-yl]ethyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 162502119) has the molecular formula C21H22FN3O and a molecular weight of 351.42 g/mol. Its IUPAC name is (E)-N-[2-[3-(3-fluorophenyl)-3-azabicyclo[3.1.0]hexan-6-yl]ethyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[2-[3-(3-fluorophenyl)-3-azabicyclo[3.1.0]hexan-6-yl]ethyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 162502119 |
| Molecular Formula | C21H22FN3O |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | (E)-N-[2-[3-(3-fluorophenyl)-3-azabicyclo[3.1.0]hexan-6-yl]ethyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccnc1)NCCC1C2CN(c3cccc(F)c3)CC12 |
| InChI | InChI=1S/C21H22FN3O/c22-16-4-1-5-17(11-16)25-13-19-18(20(19)14-25)8-10-24-21(26)7-6-15-3-2-9-23-12-15/h1-7,9,11-12,18-20H,8,10,13-14H2,(H,24,26)/b7-6+ |
| InChIKey | YNTPFZOAJNCFID-VOTSOKGWSA-N |
| XLogP | 3.12 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|