C19H21N5O — CID 146836451
(E)-3-pyridin-3-yl-N-[2-[(1S,5R)-3-pyrimidin-4-yl-3-azabicyclo[3.1.0]hexan-6-yl]ethyl]prop-2-enamide (PubChem CID 146836451) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is (E)-3-pyridin-3-yl-N-[2-[(1S,5R)-3-pyrimidin-4-yl-3-azabicyclo[3.1.0]hexan-6-yl]ethyl]prop-2-enamide.
| Compound Name | (E)-3-pyridin-3-yl-N-[2-[(1S,5R)-3-pyrimidin-4-yl-3-azabicyclo[3.1.0]hexan-6-yl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 146836451 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | (E)-3-pyridin-3-yl-N-[2-[(1S,5R)-3-pyrimidin-4-yl-3-azabicyclo[3.1.0]hexan-6-yl]ethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cccnc1)NCCC1[C@H]2CN(c3ccncn3)C[C@@H]12 |
| InChI | InChI=1S/C19H21N5O/c25-19(4-3-14-2-1-7-20-10-14)22-9-5-15-16-11-24(12-17(15)16)18-6-8-21-13-23-18/h1-4,6-8,10,13,15-17H,5,9,11-12H2,(H,22,25)/b4-3+/t15?,16-,17+ |
| InChIKey | SFFCEMUIYBXWBF-WWDSTUENSA-N |
| XLogP | 1.77 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|