C21H32N4O3 — CID 162502080
tert-butyl 5-[(pyridin-3-ylmethylcarbamoylamino)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate (PubChem CID 162502080) has the molecular formula C21H32N4O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is tert-butyl 5-[(pyridin-3-ylmethylcarbamoylamino)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate.
| Compound Name | tert-butyl 5-[(pyridin-3-ylmethylcarbamoylamino)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 162502080 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | tert-butyl 5-[(pyridin-3-ylmethylcarbamoylamino)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CCC(CNC(=O)NCc3cccnc3)CC2C1 |
| InChI | InChI=1S/C21H32N4O3/c1-21(2,3)28-20(27)25-13-17-7-6-15(9-18(17)14-25)11-23-19(26)24-12-16-5-4-8-22-10-16/h4-5,8,10,15,17-18H,6-7,9,11-14H2,1-3H3,(H2,23,24,26) |
| InChIKey | SSGREYLXACYDLJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |