C29H41N5O3 — CID 71144252
tert-butyl 3-[3-[6-(pyridin-3-ylmethylcarbamoylamino)hexyl]-2,3-dihydroindol-1-yl]azetidine-1-carboxylate (PubChem CID 71144252) has the molecular formula C29H41N5O3 and a molecular weight of 507.68 g/mol. Its IUPAC name is tert-butyl 3-[3-[6-(pyridin-3-ylmethylcarbamoylamino)hexyl]-2,3-dihydroindol-1-yl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[3-[6-(pyridin-3-ylmethylcarbamoylamino)hexyl]-2,3-dihydroindol-1-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 71144252 |
| Molecular Formula | C29H41N5O3 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.32 |
| IUPAC Name | tert-butyl 3-[3-[6-(pyridin-3-ylmethylcarbamoylamino)hexyl]-2,3-dihydroindol-1-yl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(N2CC(CCCCCCNC(=O)NCc3cccnc3)c3ccccc32)C1 |
| InChI | InChI=1S/C29H41N5O3/c1-29(2,3)37-28(36)33-20-24(21-33)34-19-23(25-13-7-8-14-26(25)34)12-6-4-5-9-16-31-27(35)32-18-22-11-10-15-30-17-22/h7-8,10-11,13-15,17,23-24H,4-6,9,12,16,18-21H2,1-3H3,(H2,31,32,35) |
| InChIKey | TXFZEQJHBLJTIZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|