C21H21N5O4 — CID 162504345
5-[(2-tert-butylpyrimidin-4-yl)amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 162504345) has the molecular formula C21H21N5O4 and a molecular weight of 407.43 g/mol. Its IUPAC name is 5-[(2-tert-butylpyrimidin-4-yl)amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[(2-tert-butylpyrimidin-4-yl)amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 162504345 |
| Molecular Formula | C21H21N5O4 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 5-[(2-tert-butylpyrimidin-4-yl)amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | CC(C)(C)c1nccc(Nc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)n1 |
| InChI | InChI=1S/C21H21N5O4/c1-21(2,3)20-22-9-8-15(24-20)23-11-4-5-12-13(10-11)19(30)26(18(12)29)14-6-7-16(27)25-17(14)28/h4-5,8-10,14H,6-7H2,1-3H3,(H,22,23,24)(H,25,27,28) |
| InChIKey | XJMGVYAVDSUBEE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|